CAS 1021325-40-5 is the registry number for 2,6-Dimethylphenol-d9 (Major), >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
3,4,5-trideuterio-2,6-bis(trideuteriomethyl)phenol (CAS 1021325-40-5) is a chemical compound with the molecular formula C8H10O and a molecular weight of 131.22 g/mol. IUPAC name: 3,4,5-trideuterio-2,6-bis(trideuteriomethyl)phenol. InChIKey: NXXYKOUNUYWIHA-XVGWXEQOSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 131.22 g/mol |
| IUPAC name | 3,4,5-trideuterio-2,6-bis(trideuteriomethyl)phenol |
| InChIKey | NXXYKOUNUYWIHA-XVGWXEQOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])O)C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)