CAS 1316315-40-8 is the registry number for 2,6-Di(methyl-d3)phenol. Offered by: TRC. Available pack sizes: 50mg.
2,6-bis(trideuteriomethyl)phenol (CAS 1316315-40-8) is a chemical compound with the molecular formula C8H10O and a molecular weight of 128.20 g/mol. IUPAC name: 2,6-bis(trideuteriomethyl)phenol. InChIKey: NXXYKOUNUYWIHA-WFGJKAKNSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 128.20 g/mol |
| IUPAC name | 2,6-bis(trideuteriomethyl)phenol |
| InChIKey | NXXYKOUNUYWIHA-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)