CAS 1021325-45-0 is the registry number for 2,6-Dimethylaniline-d9, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
3,4,5-trideuterio-2,6-bis(trideuteriomethyl)aniline (CAS 1021325-45-0) is a chemical compound with the molecular formula C8H11N and a molecular weight of 130.23 g/mol. IUPAC name: 3,4,5-trideuterio-2,6-bis(trideuteriomethyl)aniline. InChIKey: UFFBMTHBGFGIHF-XVGWXEQOSA-N.
| Molecular formula | C8H11N |
|---|---|
| Molecular weight | 130.23 g/mol |
| IUPAC name | 3,4,5-trideuterio-2,6-bis(trideuteriomethyl)aniline |
| InChIKey | UFFBMTHBGFGIHF-XVGWXEQOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])N)C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)