CAS 1092805-08-7 appears in our catalog under these names: 2,6-Dimethylaniline-d11, 2,6-Dimethylaniline-d11, 98 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, TRC, CDN. Available pack sizes: on request, 10mg, 1mg, 2mg, 0,1g, 0,05g.
N,N,3,4,5-pentadeuterio-2,6-bis(trideuteriomethyl)aniline (CAS 1092805-08-7) is a chemical compound with the molecular formula C8H11N and a molecular weight of 132.25 g/mol. IUPAC name: N,N,3,4,5-pentadeuterio-2,6-bis(trideuteriomethyl)aniline. InChIKey: UFFBMTHBGFGIHF-MDCKYEMWSA-N.
| Molecular formula | C8H11N |
|---|---|
| Molecular weight | 132.25 g/mol |
| IUPAC name | N,N,3,4,5-pentadeuterio-2,6-bis(trideuteriomethyl)aniline |
| InChIKey | UFFBMTHBGFGIHF-MDCKYEMWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])N([2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)