CAS 1021580-60-8 appears in our catalog under these names: 2-Chloro-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-amine, 95%, 2-Chloro-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-amine, ≥95%, ≥95%, 2-Chloro-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-amine. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
3-chloro-4-[4-(trifluoromethyl)phenyl]aniline (CAS 1021580-60-8) is a chemical compound with the molecular formula C13H9ClF3N and a molecular weight of 271.66 g/mol. IUPAC name: 3-chloro-4-[4-(trifluoromethyl)phenyl]aniline. InChIKey: DBYKSGNVEGGSGA-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF3N |
|---|---|
| Molecular weight | 271.66 g/mol |
| IUPAC name | 3-chloro-4-[4-(trifluoromethyl)phenyl]aniline |
| InChIKey | DBYKSGNVEGGSGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)