Products 1261747-48-1
CAS 1261747-48-1 appears in our catalog under these names: 2-CHLORO-4'-(TRIFLUOROMETHYL)BIPHENYL-3-AMINE, 95%, 2-Chloro-4'-(trifluoromethyl)-[1,1'-biphenyl]-3-amine, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-3-[4-(trifluoromethyl)phenyl]aniline (CAS 1261747-48-1) is a chemical compound with the molecular formula C13H9ClF3N and a molecular weight of 271.66 g/mol. IUPAC name: 2-chloro-3-[4-(trifluoromethyl)phenyl]aniline. InChIKey: VSZCRSSLVZMFJS-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF3N |
|---|---|
| Molecular weight | 271.66 g/mol |
| IUPAC name | 2-chloro-3-[4-(trifluoromethyl)phenyl]aniline |
| InChIKey | VSZCRSSLVZMFJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)Cl)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)