CAS 10216-12-3 is the registry number for 5-(Chlorosulfonyl)thiophene-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-chlorosulfonylthiophene-2-carboxylic acid (CAS 10216-12-3) is a chemical compound with the molecular formula C5H3ClO4S2 and a molecular weight of 226.7 g/mol. IUPAC name: 5-chlorosulfonylthiophene-2-carboxylic acid. InChIKey: FWVXNSQOBHTXGV-UHFFFAOYSA-N.
| Molecular formula | C5H3ClO4S2 |
|---|---|
| Molecular weight | 226.7 g/mol |
| IUPAC name | 5-chlorosulfonylthiophene-2-carboxylic acid |
| InChIKey | FWVXNSQOBHTXGV-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)