Products 741653-98-5
CAS 741653-98-5 is the registry number for 3-(chlorosulfonyl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chlorosulfonylthiophene-2-carboxylic acid (CAS 741653-98-5) is a chemical compound with the molecular formula C5H3ClO4S2 and a molecular weight of 226.7 g/mol. IUPAC name: 3-chlorosulfonylthiophene-2-carboxylic acid. InChIKey: VWWFEZXWHBORHN-UHFFFAOYSA-N.
| Molecular formula | C5H3ClO4S2 |
|---|---|
| Molecular weight | 226.7 g/mol |
| IUPAC name | 3-chlorosulfonylthiophene-2-carboxylic acid |
| InChIKey | VWWFEZXWHBORHN-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)