Products 1021726-10-2

CAS 1021726-10-2 is the registry number for (4-Fluorophenyl)carbamic chloride 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

N-(4-fluorophenyl)carbamoyl chloride (CAS 1021726-10-2) is a chemical compound with the molecular formula C7H5ClFNO and a molecular weight of 173.57 g/mol. IUPAC name: N-(4-fluorophenyl)carbamoyl chloride. InChIKey: PQJOAOKXAAHJKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClFNO
Molecular weight173.57 g/mol
IUPAC nameN-(4-fluorophenyl)carbamoyl chloride
InChIKeyPQJOAOKXAAHJKZ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC(=O)Cl)F

Computed by PubChem (NCBI)