Products 1021859-29-9
CAS 1021859-29-9 appears in our catalog under these names: 6-Bromo-1-methyl-1h-indazole-3-carboxylic acid, 98%, 6-Bromo-1-methyl-1H-indazole-3-carboxylic acid, 97%, 6-bromo-1-methyl-1H-indazole-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg, 500mg.
6-bromo-1-methylindazole-3-carboxylic acid (CAS 1021859-29-9) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 6-bromo-1-methylindazole-3-carboxylic acid. InChIKey: OPJAPPYKVWTEQM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 6-bromo-1-methylindazole-3-carboxylic acid |
| InChIKey | OPJAPPYKVWTEQM-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)C(=N1)C(=O)O |
Computed by PubChem (NCBI)