CAS 1021870-78-9 is the registry number for 4-Amino-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-amino-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile (CAS 1021870-78-9) is a chemical compound with the molecular formula C12H8N6 and a molecular weight of 236.23 g/mol. IUPAC name: 4-amino-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile. InChIKey: LUTMRFQKVPAKDW-UHFFFAOYSA-N.
| Molecular formula | C12H8N6 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | 4-amino-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile |
| InChIKey | LUTMRFQKVPAKDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3N=NC(=C(N3N=C2)N)C#N |
Computed by PubChem (NCBI)