CAS 1241170-40-0 is the registry number for 1-(4-Methylphthalazin-1-yl)-1H-1,2,4-triazole-3-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methylphthalazin-1-yl)-1,2,4-triazole-3-carbonitrile (CAS 1241170-40-0) is a chemical compound with the molecular formula C12H8N6 and a molecular weight of 236.23 g/mol. IUPAC name: 1-(4-methylphthalazin-1-yl)-1,2,4-triazole-3-carbonitrile. InChIKey: BBQIIOMHNHTWPZ-UHFFFAOYSA-N.
| Molecular formula | C12H8N6 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | 1-(4-methylphthalazin-1-yl)-1,2,4-triazole-3-carbonitrile |
| InChIKey | BBQIIOMHNHTWPZ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(C2=CC=CC=C12)N3C=NC(=N3)C#N |
Computed by PubChem (NCBI)