CAS 10219-04-2 is the registry number for N-Methyl-N-(3-fluorophenyl)-thiocarbamoyl chloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
N-(3-fluorophenyl)-N-methylcarbamothioyl chloride (CAS 10219-04-2) is a chemical compound with the molecular formula C8H7ClFNS and a molecular weight of 203.66 g/mol. IUPAC name: N-(3-fluorophenyl)-N-methylcarbamothioyl chloride. InChIKey: HSDZSNCIZXXUGE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNS |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | N-(3-fluorophenyl)-N-methylcarbamothioyl chloride |
| InChIKey | HSDZSNCIZXXUGE-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=CC=C1)F)C(=S)Cl |
Computed by PubChem (NCBI)