CAS 306937-36-0 is the registry number for 2-(2-Chloro-4-fluorophenyl)ethanethioamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-(2-chloro-4-fluorophenyl)ethanethioamide (CAS 306937-36-0) is a chemical compound with the molecular formula C8H7ClFNS and a molecular weight of 203.66 g/mol. IUPAC name: 2-(2-chloro-4-fluorophenyl)ethanethioamide. InChIKey: WPGSTNBGSBXLKT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNS |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 2-(2-chloro-4-fluorophenyl)ethanethioamide |
| InChIKey | WPGSTNBGSBXLKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)CC(=S)N |
Computed by PubChem (NCBI)