Products 1021923-54-5
CAS 1021923-54-5 appears in our catalog under these names: 7-Bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine, 95%, 7-Bromo-3-(trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyridine, 98%, 7-Bromo-3-(trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyridine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 10g, 50mg, 0,5g.
7-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (CAS 1021923-54-5) is a chemical compound with the molecular formula C7H3BrF3N3 and a molecular weight of 266.02 g/mol. IUPAC name: 7-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: ITGHKULKAFKZIA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3N3 |
|---|---|
| Molecular weight | 266.02 g/mol |
| IUPAC name | 7-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | ITGHKULKAFKZIA-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NN=C2C(F)(F)F)C=C1Br |
Computed by PubChem (NCBI)