CAS 1170302-00-7 appears in our catalog under these names: 8-Bromo-6-trifluoromethyl[1,2,4]triazolo[1,5-a]pyridine, 95%, 8-Bromo-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine, 98%, 98%, 8-Bromo-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
8-bromo-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (CAS 1170302-00-7) is a chemical compound with the molecular formula C7H3BrF3N3 and a molecular weight of 266.02 g/mol. IUPAC name: 8-bromo-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: FMPBLFALLZDQGA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3N3 |
|---|---|
| Molecular weight | 266.02 g/mol |
| IUPAC name | 8-bromo-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | FMPBLFALLZDQGA-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC=NN2C=C1C(F)(F)F)Br |
Computed by PubChem (NCBI)