CAS 1022024-04-9 is the registry number for 1-((2,4-Dichlorophenyl)sulfonyl)piperidin-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2,4-dichlorophenyl)sulfonylpiperidin-4-ol (CAS 1022024-04-9) is a chemical compound with the molecular formula C11H13Cl2NO3S and a molecular weight of 310.2 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)sulfonylpiperidin-4-ol. InChIKey: NVZGUKRGNIXAIF-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO3S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)sulfonylpiperidin-4-ol |
| InChIKey | NVZGUKRGNIXAIF-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1O)S(=O)(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)