Products 1909337-37-6

CAS 1909337-37-6 appears in our catalog under these names: 4-(5-Chloropentanamido)benzene-1-sulfonyl chloride, 95%, 4-(5-Chloropentanamido)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

4-(5-chloropentanoylamino)benzenesulfonyl chloride (CAS 1909337-37-6) is a chemical compound with the molecular formula C11H13Cl2NO3S and a molecular weight of 310.2 g/mol. IUPAC name: 4-(5-chloropentanoylamino)benzenesulfonyl chloride. InChIKey: YKWUQUHDCHPGLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13Cl2NO3S
Molecular weight310.2 g/mol
IUPAC name4-(5-chloropentanoylamino)benzenesulfonyl chloride
InChIKeyYKWUQUHDCHPGLZ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC(=O)CCCCCl)S(=O)(=O)Cl

Computed by PubChem (NCBI)