CAS 1909337-37-6 appears in our catalog under these names: 4-(5-Chloropentanamido)benzene-1-sulfonyl chloride, 95%, 4-(5-Chloropentanamido)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(5-chloropentanoylamino)benzenesulfonyl chloride (CAS 1909337-37-6) is a chemical compound with the molecular formula C11H13Cl2NO3S and a molecular weight of 310.2 g/mol. IUPAC name: 4-(5-chloropentanoylamino)benzenesulfonyl chloride. InChIKey: YKWUQUHDCHPGLZ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO3S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4-(5-chloropentanoylamino)benzenesulfonyl chloride |
| InChIKey | YKWUQUHDCHPGLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CCCCCl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)