Products 1022094-45-6

CAS 1022094-45-6 is the registry number for 4-(2,2-Difluorovinyl)biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(2,2-difluoroethenyl)-4-phenylbenzene (CAS 1022094-45-6) is a chemical compound with the molecular formula C14H10F2 and a molecular weight of 216.22 g/mol. IUPAC name: 1-(2,2-difluoroethenyl)-4-phenylbenzene. InChIKey: VOXKSAHNCGAIFN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10F2
Molecular weight216.22 g/mol
IUPAC name1-(2,2-difluoroethenyl)-4-phenylbenzene
InChIKeyVOXKSAHNCGAIFN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=C(C=C2)C=C(F)F

Computed by PubChem (NCBI)