CAS 6175-14-0 is the registry number for 1,1-Bis(4-fluorophenyl)ethene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
1-fluoro-4-[1-(4-fluorophenyl)ethenyl]benzene (CAS 6175-14-0) is a chemical compound with the molecular formula C14H10F2 and a molecular weight of 216.22 g/mol. IUPAC name: 1-fluoro-4-[1-(4-fluorophenyl)ethenyl]benzene. InChIKey: OKWIEHVHIHQUFB-UHFFFAOYSA-N.
| Molecular formula | C14H10F2 |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | 1-fluoro-4-[1-(4-fluorophenyl)ethenyl]benzene |
| InChIKey | OKWIEHVHIHQUFB-UHFFFAOYSA-N |
| SMILES | C=C(C1=CC=C(C=C1)F)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)