CAS 1022128-17-1 is the registry number for N-(2-benzoylphenyl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-benzoylphenyl)-1-phenylcyclopentane-1-carboxamide (CAS 1022128-17-1) is a chemical compound with the molecular formula C25H23NO2 and a molecular weight of 369.5 g/mol. IUPAC name: N-(2-benzoylphenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: YBTNCNBKONXGBH-UHFFFAOYSA-N.
| Molecular formula | C25H23NO2 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | N-(2-benzoylphenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | YBTNCNBKONXGBH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC=CC=C3C(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)