CAS 305811-90-9 is the registry number for 2,2,4-Trimethyl-1,2-dihydroquinolin-6-yl biphenyl-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,2,4-trimethyl-1H-quinolin-6-yl) 4-phenylbenzoate (CAS 305811-90-9) is a chemical compound with the molecular formula C25H23NO2 and a molecular weight of 369.5 g/mol. IUPAC name: (2,2,4-trimethyl-1H-quinolin-6-yl) 4-phenylbenzoate. InChIKey: UODBHJHLEHHAKD-UHFFFAOYSA-N.
| Molecular formula | C25H23NO2 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | (2,2,4-trimethyl-1H-quinolin-6-yl) 4-phenylbenzoate |
| InChIKey | UODBHJHLEHHAKD-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)OC(=O)C3=CC=C(C=C3)C4=CC=CC=C4)(C)C |
Computed by PubChem (NCBI)