CAS 1022154-80-8 is the registry number for 4-Acetyl-2,5-difluorobenzeneboronic acid pinacol ester, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
1-[2,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 1022154-80-8) is a chemical compound with the molecular formula C14H17BF2O3 and a molecular weight of 282.09 g/mol. IUPAC name: 1-[2,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: NDJMQXWRZUTNSA-UHFFFAOYSA-N.
| Molecular formula | C14H17BF2O3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | 1-[2,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | NDJMQXWRZUTNSA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)C(=O)C)F |
Computed by PubChem (NCBI)