CAS 2121511-81-5 appears in our catalog under these names: 4-Acetyl-2,3-difluorophenylboronic acid pinacol ester, 95%, 1-(2,3-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethan-1-one, 98%, 4-Acetyl-2,3-difluorophenylboronic acid pinacol ester, ≥95%, ≥95%, 4-Acetyl-2,3-difluorophenylboronic acid pinacol ester, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 2121511-81-5) is a chemical compound with the molecular formula C14H17BF2O3 and a molecular weight of 282.09 g/mol. IUPAC name: 1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: SBFARIKWYCEUPJ-UHFFFAOYSA-N.
| Molecular formula | C14H17BF2O3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | 1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | SBFARIKWYCEUPJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)C(=O)C)F)F |
Computed by PubChem (NCBI)