Products 1022394-02-0
CAS 1022394-02-0 is the registry number for 1-(indan-5-yl)-3-(3-(phenylmethoxy)(2-pyridyl))urea. Offered by: Biosynth. Available pack sizes: 250mg.
1-(2,3-dihydro-1H-inden-5-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea (CAS 1022394-02-0) is a chemical compound with the molecular formula C22H21N3O2 and a molecular weight of 359.4 g/mol. IUPAC name: 1-(2,3-dihydro-1H-inden-5-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea. InChIKey: BOKXNKTUDCBIED-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O2 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 1-(2,3-dihydro-1H-inden-5-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea |
| InChIKey | BOKXNKTUDCBIED-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)NC(=O)NC3=C(C=CC=N3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)