Products 381173-58-6
CAS 381173-58-6 is the registry number for HP1142. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(3,4-dimethoxyphenyl)methyl]-1-phenylbenzimidazol-5-amine (CAS 381173-58-6) is a chemical compound with the molecular formula C22H21N3O2 and a molecular weight of 359.4 g/mol. IUPAC name: N-[(3,4-dimethoxyphenyl)methyl]-1-phenylbenzimidazol-5-amine. InChIKey: OOKFRASIHFMNAG-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O2 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | N-[(3,4-dimethoxyphenyl)methyl]-1-phenylbenzimidazol-5-amine |
| InChIKey | OOKFRASIHFMNAG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CNC2=CC3=C(C=C2)N(C=N3)C4=CC=CC=C4)OC |
Computed by PubChem (NCBI)