CAS 1022401-41-7 is the registry number for 2,2-diphenyl-N-(3-(phenylmethoxy)(2-pyridyl))ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2,2-diphenyl-N-(3-phenylmethoxy-2-pyridinyl)acetamide (CAS 1022401-41-7) is a chemical compound with the molecular formula C26H22N2O2 and a molecular weight of 394.5 g/mol. IUPAC name: 2,2-diphenyl-N-(3-phenylmethoxy-2-pyridinyl)acetamide. InChIKey: PDPBSRDFGCHSRG-UHFFFAOYSA-N.
| Molecular formula | C26H22N2O2 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 2,2-diphenyl-N-(3-phenylmethoxy-2-pyridinyl)acetamide |
| InChIKey | PDPBSRDFGCHSRG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC=C2)NC(=O)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)