CAS 102243-12-9 is the registry number for 4-[(4,6-Dimethylpyrimidin-2-yl)thio]aniline, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 500mg, 2.5g, 10g.
4-(4,6-dimethylpyrimidin-2-yl)sulfanylaniline (CAS 102243-12-9) is a chemical compound with the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. IUPAC name: 4-(4,6-dimethylpyrimidin-2-yl)sulfanylaniline. InChIKey: FPLNYQRUEFPJPX-UHFFFAOYSA-N.
| Molecular formula | C12H13N3S |
|---|---|
| Molecular weight | 231.32 g/mol |
| IUPAC name | 4-(4,6-dimethylpyrimidin-2-yl)sulfanylaniline |
| InChIKey | FPLNYQRUEFPJPX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SC2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)