Products 2306263-33-0
CAS 2306263-33-0 is the registry number for 3-(2,6-Diazaspiro[3.3]heptan-2-yl)benzo[d]isothiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,6-diazaspiro[3.3]heptan-2-yl)-1,2-benzothiazole (CAS 2306263-33-0) is a chemical compound with the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. IUPAC name: 3-(2,6-diazaspiro[3.3]heptan-2-yl)-1,2-benzothiazole. InChIKey: PALWEXYEHREPBF-UHFFFAOYSA-N.
| Molecular formula | C12H13N3S |
|---|---|
| Molecular weight | 231.32 g/mol |
| IUPAC name | 3-(2,6-diazaspiro[3.3]heptan-2-yl)-1,2-benzothiazole |
| InChIKey | PALWEXYEHREPBF-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)C3=NSC4=CC=CC=C43 |
Computed by PubChem (NCBI)