CAS 1022480-78-9 is the registry number for 1-(3,5-dichlorophenyl)-2,6-dimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-(3,5-dichlorophenyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one (CAS 1022480-78-9) is a chemical compound with the molecular formula C16H15Cl2NO and a molecular weight of 308.2 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one. InChIKey: QQLNQZSXHJSAHN-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one |
| InChIKey | QQLNQZSXHJSAHN-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C=C(N2C3=CC(=CC(=C3)Cl)Cl)C)C(=O)C1 |
Computed by PubChem (NCBI)