Products 1170701-78-6
CAS 1170701-78-6 appears in our catalog under these names: N-Desmethyl Asenapine HCl, N-Desmethyl Asenapine Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg, 5mg.
(2R,6R)-9-chloro-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene;hydrochloride (CAS 1170701-78-6) is a chemical compound with the molecular formula C16H15Cl2NO and a molecular weight of 308.2 g/mol. IUPAC name: (2R,6R)-9-chloro-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene;hydrochloride. InChIKey: ONMMHDIXIDXKTN-IODNYQNNSA-N.
| Molecular formula | C16H15Cl2NO |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | (2R,6R)-9-chloro-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene;hydrochloride |
| InChIKey | ONMMHDIXIDXKTN-IODNYQNNSA-N |
| SMILES | C1[C@@H]2[C@@H](CN1)C3=C(C=CC(=C3)Cl)OC4=CC=CC=C24.Cl |
Computed by PubChem (NCBI)
Synonyms:
N-Desmethyl Asenapine Hydrochloride