CAS 1022491-16-2 is the registry number for N-(3-(phenylmethoxy)(2-pyridyl))(4-phenylphenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-phenyl-N-(3-phenylmethoxy-2-pyridinyl)benzamide (CAS 1022491-16-2) is a chemical compound with the molecular formula C25H20N2O2 and a molecular weight of 380.4 g/mol. IUPAC name: 4-phenyl-N-(3-phenylmethoxy-2-pyridinyl)benzamide. InChIKey: HTYREZKXRMCUKW-UHFFFAOYSA-N.
| Molecular formula | C25H20N2O2 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 4-phenyl-N-(3-phenylmethoxy-2-pyridinyl)benzamide |
| InChIKey | HTYREZKXRMCUKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC=C2)NC(=O)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)