CAS 1022511-28-9 is the registry number for 1-(4-chloro-3-nitrophenyl)-2,6,6-trimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-chloro-3-nitrophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (CAS 1022511-28-9) is a chemical compound with the molecular formula C17H17ClN2O3 and a molecular weight of 332.8 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one. InChIKey: BFASLLAFMNABSF-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2O3 |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | 1-(4-chloro-3-nitrophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| InChIKey | BFASLLAFMNABSF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC(=C(C=C3)Cl)[N+](=O)[O-])CC(CC2=O)(C)C |
Computed by PubChem (NCBI)