CAS 356102-14-2 appears in our catalog under these names: 2-(4-Chloro-2-methylphenoxy)-N'-(2-methoxybenzylidene)acetohydrazide, 95%, 95%, Ani9/ 98.72% (existing batch purity), Ani 9, Ani 9, Ani9, 99.12%. Offered by: Chemat, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1mg, 500mg.
2-(4-chloro-2-methylphenoxy)-N-[(E)-(2-methoxyphenyl)methylideneamino]acetamide (CAS 356102-14-2) is a chemical compound with the molecular formula C17H17ClN2O3 and a molecular weight of 332.8 g/mol. IUPAC name: 2-(4-chloro-2-methylphenoxy)-N-[(E)-(2-methoxyphenyl)methylideneamino]acetamide. InChIKey: KDALDZRKOBJXIE-VXLYETTFSA-N.
| Molecular formula | C17H17ClN2O3 |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | 2-(4-chloro-2-methylphenoxy)-N-[(E)-(2-methoxyphenyl)methylideneamino]acetamide |
| InChIKey | KDALDZRKOBJXIE-VXLYETTFSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OCC(=O)N/N=C/C2=CC=CC=C2OC |
Computed by PubChem (NCBI)