CAS 1022609-79-5 is the registry number for 2-(((2,4-difluorophenyl)amino)methylene)cyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one (CAS 1022609-79-5) is a chemical compound with the molecular formula C13H11F2NO2 and a molecular weight of 251.23 g/mol. IUPAC name: 2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one. InChIKey: LNRKPMMQDAXROX-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO2 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one |
| InChIKey | LNRKPMMQDAXROX-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C(=O)C1)C=NC2=C(C=C(C=C2)F)F)O |
Computed by PubChem (NCBI)