CAS 586379-20-6 is the registry number for 2(1H)-Pyridinone, 4-[(2,4-difluorophenyl)methoxy]-6-methyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(2,4-difluorophenyl)methoxy]-6-methyl-1H-pyridin-2-one (CAS 586379-20-6) is a chemical compound with the molecular formula C13H11F2NO2 and a molecular weight of 251.23 g/mol. IUPAC name: 4-[(2,4-difluorophenyl)methoxy]-6-methyl-1H-pyridin-2-one. InChIKey: GLOFGBXOHXBZHQ-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO2 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 4-[(2,4-difluorophenyl)methoxy]-6-methyl-1H-pyridin-2-one |
| InChIKey | GLOFGBXOHXBZHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=O)N1)OCC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)