Products 1022860-49-6
CAS 1022860-49-6 is the registry number for 5-phenyl-3-((4-(trifluoromethoxy)phenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
5-phenyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-one (CAS 1022860-49-6) is a chemical compound with the molecular formula C19H16F3NO2 and a molecular weight of 347.3 g/mol. IUPAC name: 5-phenyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-one. InChIKey: DEBQXYKYKLYOKB-UHFFFAOYSA-N.
| Molecular formula | C19H16F3NO2 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 5-phenyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-one |
| InChIKey | DEBQXYKYKLYOKB-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)C=C1NC2=CC=C(C=C2)OC(F)(F)F)C3=CC=CC=C3 |
Computed by PubChem (NCBI)