CAS 1956381-99-9 is the registry number for benzyl 2–(4–(trifluoromethyl)phenyl)–2,5–dihydro–1H–pyrrole–1–carboxylate. Offered by: GLPBio. Available pack sizes: 200mg.
Benzyl 2-[4-(trifluoromethyl)phenyl]-2,5-dihydropyrrole-1-carboxylate (CAS 1956381-99-9) is a chemical compound with the molecular formula C19H16F3NO2 and a molecular weight of 347.3 g/mol. IUPAC name: benzyl 2-[4-(trifluoromethyl)phenyl]-2,5-dihydropyrrole-1-carboxylate. InChIKey: WZOGZJVHEQMWSK-UHFFFAOYSA-N.
| Molecular formula | C19H16F3NO2 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | benzyl 2-[4-(trifluoromethyl)phenyl]-2,5-dihydropyrrole-1-carboxylate |
| InChIKey | WZOGZJVHEQMWSK-UHFFFAOYSA-N |
| SMILES | C1C=CC(N1C(=O)OCC2=CC=CC=C2)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)