CAS 1022879-60-2 is the registry number for 2-(((4-(trifluoromethoxy)phenyl)amino)methylene)cyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
3-hydroxy-2-[[4-(trifluoromethoxy)phenyl]iminomethyl]cyclohex-2-en-1-one (CAS 1022879-60-2) is a chemical compound with the molecular formula C14H12F3NO3 and a molecular weight of 299.24 g/mol. IUPAC name: 3-hydroxy-2-[[4-(trifluoromethoxy)phenyl]iminomethyl]cyclohex-2-en-1-one. InChIKey: YLNOSOSTUWMYTE-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO3 |
|---|---|
| Molecular weight | 299.24 g/mol |
| IUPAC name | 3-hydroxy-2-[[4-(trifluoromethoxy)phenyl]iminomethyl]cyclohex-2-en-1-one |
| InChIKey | YLNOSOSTUWMYTE-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C(=O)C1)C=NC2=CC=C(C=C2)OC(F)(F)F)O |
Computed by PubChem (NCBI)