CAS 2120057-34-1 is the registry number for Ethyl 2-methyl-1-oxo-4-(trifluoromethyl)-1,2-dihydroisoquinoline-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-methyl-1-oxo-4-(trifluoromethyl)isoquinoline-6-carboxylate (CAS 2120057-34-1) is a chemical compound with the molecular formula C14H12F3NO3 and a molecular weight of 299.24 g/mol. IUPAC name: ethyl 2-methyl-1-oxo-4-(trifluoromethyl)isoquinoline-6-carboxylate. InChIKey: ZJKFYLFGMSFRPI-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO3 |
|---|---|
| Molecular weight | 299.24 g/mol |
| IUPAC name | ethyl 2-methyl-1-oxo-4-(trifluoromethyl)isoquinoline-6-carboxylate |
| InChIKey | ZJKFYLFGMSFRPI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C(=O)N(C=C2C(F)(F)F)C |
Computed by PubChem (NCBI)