Products 1022931-48-1
CAS 1022931-48-1 is the registry number for 3-(Trifluoromethyl)-1,4,5,7-tetrahydropyrano(3,4-c)pyrazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(trifluoromethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole (CAS 1022931-48-1) is a chemical compound with the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. IUPAC name: 3-(trifluoromethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole. InChIKey: AGJBKVPDGFHFLU-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 3-(trifluoromethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole |
| InChIKey | AGJBKVPDGFHFLU-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C(=NN2)C(F)(F)F |
Computed by PubChem (NCBI)