CAS 1023301-88-3 appears in our catalog under these names: tert-Butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate hydrochloride, 95%, tert–Butyl 2,9–diazaspiro(5·5)undecane–2–carboxylate hydrochloride, 2-Boc-2,9-Diazaspiro(5.5)undecane hydrochloride, tert-Butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate hydrochloride 97%, tert-Butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate hydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
Tert-butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate;hydrochloride (CAS 1023301-88-3) is a chemical compound with the molecular formula C14H27ClN2O2 and a molecular weight of 290.83 g/mol. IUPAC name: tert-butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate;hydrochloride. InChIKey: CRHPGRDEEKJUJD-UHFFFAOYSA-N.
| Molecular formula | C14H27ClN2O2 |
|---|---|
| Molecular weight | 290.83 g/mol |
| IUPAC name | tert-butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate;hydrochloride |
| InChIKey | CRHPGRDEEKJUJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCNCC2.Cl |
Computed by PubChem (NCBI)