CAS 236406-47-6 appears in our catalog under these names: 3–Boc–3,9–diazaspiro(5·5)undecane Hydrochloride, tert-Butyl 3,9-diazaspiro(5.5)undecane-3-carboxylate hydrochloride, tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride, 97%, 97%, 3-Boc-3,9-Diazaspiro[5.5]undecane (hydrochloride), 97.0%, tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 50g, 5g, 100mg, 10g, 25g, 10 g.
Tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate;hydrochloride (CAS 236406-47-6) is a chemical compound with the molecular formula C14H27ClN2O2 and a molecular weight of 290.83 g/mol. IUPAC name: tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate;hydrochloride. InChIKey: SABRTFCGXPHVTA-UHFFFAOYSA-N.
| Molecular formula | C14H27ClN2O2 |
|---|---|
| Molecular weight | 290.83 g/mol |
| IUPAC name | tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate;hydrochloride |
| InChIKey | SABRTFCGXPHVTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNCC2)CC1.Cl |
Computed by PubChem (NCBI)