Products 1023494-92-9
CAS 1023494-92-9 is the registry number for N-(3-hydroxyphenyl)(phenylcyclopentyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(3-hydroxyphenyl)-1-phenylcyclopentane-1-carboxamide (CAS 1023494-92-9) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: N-(3-hydroxyphenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: JBVYHSDAFJHIPF-UHFFFAOYSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | N-(3-hydroxyphenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | JBVYHSDAFJHIPF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC(=CC=C3)O |
Computed by PubChem (NCBI)