CAS 1023498-24-9 is the registry number for 2,4-dichlorophenyl 6-methyl(1,2,3,4-tetrahydroquinolyl) ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(2,4-dichlorophenyl)-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone (CAS 1023498-24-9) is a chemical compound with the molecular formula C17H15Cl2NO and a molecular weight of 320.2 g/mol. IUPAC name: (2,4-dichlorophenyl)-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone. InChIKey: DUAMEIMKGVWYAQ-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2NO |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | (2,4-dichlorophenyl)-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone |
| InChIKey | DUAMEIMKGVWYAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(CCC2)C(=O)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)