Products 1023505-32-9
CAS 1023505-32-9 is the registry number for 1-(2-(3-chlorophenyl)acetyl)-4-phenylthiosemicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
1-[[2-(3-chlorophenyl)acetyl]amino]-3-phenylthiourea (CAS 1023505-32-9) is a chemical compound with the molecular formula C15H14ClN3OS and a molecular weight of 319.8 g/mol. IUPAC name: 1-[[2-(3-chlorophenyl)acetyl]amino]-3-phenylthiourea. InChIKey: QLJFNSRZLKMABI-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3OS |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | 1-[[2-(3-chlorophenyl)acetyl]amino]-3-phenylthiourea |
| InChIKey | QLJFNSRZLKMABI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=S)NNC(=O)CC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)