Products 72293-65-3
CAS 72293-65-3 is the registry number for N-{((4-Chlorophenyl)carbamothioyl)amino}-2-phenylacetamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-chlorophenyl)-3-[(2-phenylacetyl)amino]thiourea (CAS 72293-65-3) is a chemical compound with the molecular formula C15H14ClN3OS and a molecular weight of 319.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-[(2-phenylacetyl)amino]thiourea. InChIKey: FIRNVVDFFZQLAX-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3OS |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-[(2-phenylacetyl)amino]thiourea |
| InChIKey | FIRNVVDFFZQLAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NNC(=S)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)