CAS 1023511-50-3 is the registry number for methyl 3-(((2,4-dichlorophenyl)sulfonyl)amino)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl 3-[(2,4-dichlorophenyl)sulfonylamino]thiophene-2-carboxylate (CAS 1023511-50-3) is a chemical compound with the molecular formula C12H9Cl2NO4S2 and a molecular weight of 366.2 g/mol. IUPAC name: methyl 3-[(2,4-dichlorophenyl)sulfonylamino]thiophene-2-carboxylate. InChIKey: OUDIAANQRFWZOO-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO4S2 |
|---|---|
| Molecular weight | 366.2 g/mol |
| IUPAC name | methyl 3-[(2,4-dichlorophenyl)sulfonylamino]thiophene-2-carboxylate |
| InChIKey | OUDIAANQRFWZOO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)NS(=O)(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)