CAS 1023511-66-1 is the registry number for 2-chloro-3-((4-fluorophenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-chloro-3-(4-fluoroanilino)cyclohex-2-en-1-one (CAS 1023511-66-1) is a chemical compound with the molecular formula C12H11ClFNO and a molecular weight of 239.67 g/mol. IUPAC name: 2-chloro-3-(4-fluoroanilino)cyclohex-2-en-1-one. InChIKey: AXXDXMAJLSNLRU-UHFFFAOYSA-N.
| Molecular formula | C12H11ClFNO |
|---|---|
| Molecular weight | 239.67 g/mol |
| IUPAC name | 2-chloro-3-(4-fluoroanilino)cyclohex-2-en-1-one |
| InChIKey | AXXDXMAJLSNLRU-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C(=O)C1)Cl)NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)