CAS 1211495-35-0 is the registry number for 2-(2-Fluorophenoxy)aniline hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2-fluorophenoxy)aniline;hydrochloride (CAS 1211495-35-0) is a chemical compound with the molecular formula C12H11ClFNO and a molecular weight of 239.67 g/mol. IUPAC name: 2-(2-fluorophenoxy)aniline;hydrochloride. InChIKey: DJDHZVLZUDWDKU-UHFFFAOYSA-N.
| Molecular formula | C12H11ClFNO |
|---|---|
| Molecular weight | 239.67 g/mol |
| IUPAC name | 2-(2-fluorophenoxy)aniline;hydrochloride |
| InChIKey | DJDHZVLZUDWDKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OC2=CC=CC=C2F.Cl |
Computed by PubChem (NCBI)